![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Active and Passive Voice_2.pdf | 2022-09-12 21:57 | 508K | |
| Adverbs_2.pdf | 2022-09-12 21:57 | 491K | |
| Determiners_2.pdf | 2022-09-12 21:57 | 512K | |
| Direct and Indirect Speech_2.pdf | 2022-09-12 21:57 | 492K | |
| Future Tense_2.pdf | 2022-09-12 21:57 | 515K | |
| Infinitives_2.pdf | 2022-09-12 21:57 | 513K | |
| Parts of Speech_2.pdf | 2022-09-12 21:57 | 514K | |
| Past Tense_2.pdf | 2022-09-12 21:57 | 465K | |
| Phrases and Clauses_2.pdf | 2022-09-12 21:57 | 520K | |
| Prepositions_2.pdf | 2022-09-12 21:57 | 480K | |
| Restrictive and Non Restrictive Clauses_2.pdf | 2022-09-12 21:57 | 537K | |
| Simple Complex and Compound Sentences_2.pdf | 2022-09-12 21:57 | 539K | |
| Transformation of Sentences_2.pdf | 2022-09-12 21:57 | 537K | |
| Word Formation_2.pdf | 2022-09-12 21:57 | 517K | |
| Word Power_2.pdf | 2022-09-12 21:57 | 529K | |
| Words likely to be confused_2.pdf | 2022-09-12 21:57 | 495K | |