![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Active and Passive Voice_2.pdf | 2022-09-12 21:57 | 508K | |
| Adjectives_2.pdf | 2022-09-12 21:57 | 1.0M | |
| Adverbs_2.pdf | 2022-09-12 21:57 | 491K | |
| Conditional Sentences_2.pdf | 2022-09-12 21:57 | 1.0M | |
| Determiners_2.pdf | 2022-09-12 21:57 | 512K | |
| Direct and Indirect Speech_2.pdf | 2022-09-12 21:57 | 492K | |
| Future Tense_2.pdf | 2022-09-12 21:57 | 515K | |
| Gerunds_2.pdf | 2022-09-12 21:57 | 1.0M | |
| Infinitives_2.pdf | 2022-09-12 21:57 | 513K | |
| Modals_2.pdf | 2022-09-12 21:57 | 1.0M | |
| Participles_2.pdf | 2022-09-12 21:57 | 1.0M | |
| Parts of Speech_2.pdf | 2022-09-12 21:57 | 514K | |
| Past Tense_2.pdf | 2022-09-12 21:57 | 465K | |
| Phrases and Clauses_2.pdf | 2022-09-12 21:57 | 520K | |
| Prepositions_2.pdf | 2022-09-12 21:57 | 480K | |
| Present tense_2.pdf | 2022-09-12 21:57 | 1.0M | |
| Punctuation_2.pdf | 2022-09-12 21:57 | 1.0M | |
| Restrictive and Non Restrictive Clauses_2.pdf | 2022-09-12 21:57 | 537K | |
| Simple Complex and Compound Sentences_2.pdf | 2022-09-12 21:57 | 539K | |
| Subject verb agreement_2.pdf | 2022-09-12 21:57 | 1.0M | |
| Transformation of Sentences_2.pdf | 2022-09-12 21:57 | 535K | |
| Types of conjunctions_2.pdf | 2022-09-12 21:57 | 1.0M | |
| Word Formation_2.pdf | 2022-09-12 21:57 | 517K | |
| Word Power_2.pdf | 2022-09-12 21:57 | 529K | |
| Words likely to be confused_2.pdf | 2022-09-12 21:57 | 495K | |
|
|---|