![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Active and Passive Voice_1.pdf | 2022-09-12 21:57 | 518K | |
| Adjectives_1.pdf | 2022-09-12 21:57 | 522K | |
| Adverbs_1.pdf | 2022-09-12 21:57 | 1.0M | |
| Conditional Sentences_1.pdf | 2022-09-12 21:57 | 517K | |
| Determiners_1.pdf | 2022-09-12 21:57 | 1.0M | |
| Direct and Indirect Speech_1.pdf | 2022-09-12 21:57 | 462K | |
| Future Tense_1.pdf | 2022-09-12 21:57 | 515K | |
| Gerunds_1.pdf | 2022-09-12 21:57 | 524K | |
| Infinitives_1.pdf | 2022-09-12 21:57 | 519K | |
| Modals_1.pdf | 2022-09-12 21:57 | 1.0M | |
| Participles_1.pdf | 2022-09-12 21:57 | 521K | |
| Parts of Speech_1.pdf | 2022-09-12 21:57 | 537K | |
| Past Tense_1.pdf | 2022-09-12 21:57 | 497K | |
| Phrases and Clauses_1.pdf | 2022-09-12 21:57 | 519K | |
| Prepositions_1.pdf | 2022-09-12 21:57 | 1.0M | |
| Present Tense_1.pdf | 2022-09-12 21:57 | 518K | |
| Punctuation_1.pdf | 2022-09-12 21:57 | 507K | |
| Restrictive and Non Restrictive Clauses_1.pdf | 2022-09-12 21:57 | 511K | |
| Simple Complex and Compound Sentences_1.pdf | 2022-09-12 21:57 | 1.0M | |
| Subject Verb Agreement_1.pdf | 2022-09-12 21:57 | 497K | |
| Transformation of Sentences_1.pdf | 2022-09-12 21:57 | 513K | |
| Types_of_Conjunctions_1.pdf | 2022-09-12 21:57 | 523K | |
| Types of Conjunctions_1.pdf | 2022-09-12 21:57 | 523K | |
| Word Formation_1.pdf | 2022-09-12 21:57 | 518K | |
| Word Power_1.pdf | 2022-09-12 21:57 | 535K | |
| Words likely to be confused_1.pdf | 2022-09-12 21:57 | 518K | |
|
|---|